C7H5FO4S — CID 89441831
6-fluoro-1,1-dioxo-6,7-dihydro-2,1λ6-benzoxathiol-3-one (PubChem CID 89441831) has the molecular formula C7H5FO4S and a molecular weight of 204.18 g/mol. Its IUPAC name is 6-fluoro-1,1-dioxo-6,7-dihydro-2,1λ6-benzoxathiol-3-one.
| Compound Name | 6-fluoro-1,1-dioxo-6,7-dihydro-2,1λ6-benzoxathiol-3-one |
|---|---|
| PubChem CID | 89441831 |
| Molecular Formula | C7H5FO4S |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | 6-fluoro-1,1-dioxo-6,7-dihydro-2,1λ6-benzoxathiol-3-one |
| SMILES | O=C1OS(=O)(=O)C2=C1C=CC(F)C2 |
| InChI | InChI=1S/C7H5FO4S/c8-4-1-2-5-6(3-4)13(10,11)12-7(5)9/h1-2,4H,3H2 |
| InChIKey | UDNYDXHZNVEZGF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|