C18H16O4S2 — CID 10882916
(11R,14S,15S,18R)-2λ6,9λ6-dithiahexacyclo[8.4.4.111,14.115,18.01,10.03,8]icosa-3,5,7,12,16-pentaene 2,2,9,9-tetraoxide (PubChem CID 10882916) has the molecular formula C18H16O4S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is (11R,14S,15S,18R)-2λ6,9λ6-dithiahexacyclo[8.4.4.111,14.115,18.01,10.03,8]icosa-3,5,7,12,16-pentaene 2,2,9,9-tetraoxide.
| Compound Name | (11R,14S,15S,18R)-2λ6,9λ6-dithiahexacyclo[8.4.4.111,14.115,18.01,10.03,8]icosa-3,5,7,12,16-pentaene 2,2,9,9-tetraoxide |
|---|---|
| PubChem CID | 10882916 |
| Molecular Formula | C18H16O4S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | (11R,14S,15S,18R)-2λ6,9λ6-dithiahexacyclo[8.4.4.111,14.115,18.01,10.03,8]icosa-3,5,7,12,16-pentaene 2,2,9,9-tetraoxide |
| SMILES | O=S1(=O)c2ccccc2S(=O)(=O)C23[C@H]4C=C[C@H](C4)C21[C@@H]1C=C[C@H]3C1 |
| InChI | InChI=1S/C18H16O4S2/c19-23(20)15-3-1-2-4-16(15)24(21,22)18-13-7-5-11(9-13)17(18,23)12-6-8-14(18)10-12/h1-8,11-14H,9-10H2/t11-,12-,13+,14+,17?,18? |
| InChIKey | QUNGEXWRIQIPCK-MOJKSZPDSA-N |
| XLogP | 2.14 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|