C27H37N3O6 — CID 89444429
5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione;1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol (PubChem CID 89444429) has the molecular formula C27H37N3O6 and a molecular weight of 499.61 g/mol. Its IUPAC name is 5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione;1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione;1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 89444429 |
| Molecular Formula | C27H37N3O6 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | 5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione;1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CCC1(c2ccccc2)C(=O)NC(=O)NC1=O.COCCc1ccc(OCC(O)CNC(C)C)cc1 |
| InChI | InChI=1S/C15H25NO3.C12H12N2O3/c1-12(2)16-10-14(17)11-19-15-6-4-13(5-7-15)8-9-18-3;1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h4-7,12,14,16-17H,8-11H2,1-3H3;3-7H,2H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | CSITXBNMYAIEAU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|