C8H12OS2 — CID 89446335
4-ethynyl-3,5-dimethyldithiane 1-oxide (PubChem CID 89446335) has the molecular formula C8H12OS2 and a molecular weight of 188.32 g/mol. Its IUPAC name is 4-ethynyl-3,5-dimethyldithiane 1-oxide.
| Compound Name | 4-ethynyl-3,5-dimethyldithiane 1-oxide |
|---|---|
| PubChem CID | 89446335 |
| Molecular Formula | C8H12OS2 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 4-ethynyl-3,5-dimethyldithiane 1-oxide |
| SMILES | C#CC1C(C)CS(=O)SC1C |
| InChI | InChI=1S/C8H12OS2/c1-4-8-6(2)5-11(9)10-7(8)3/h1,6-8H,5H2,2-3H3 |
| InChIKey | XMSYCJXUJVTDCH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|