C12H16O3S — CID 59942026
4,5-diethynyl-3-methoxy-2-methyl-6-methylsulfinyloxane (PubChem CID 59942026) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 4,5-diethynyl-3-methoxy-2-methyl-6-methylsulfinyloxane.
| Compound Name | 4,5-diethynyl-3-methoxy-2-methyl-6-methylsulfinyloxane |
|---|---|
| PubChem CID | 59942026 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 4,5-diethynyl-3-methoxy-2-methyl-6-methylsulfinyloxane |
| SMILES | C#CC1C(C#C)C(S(C)=O)OC(C)C1OC |
| InChI | InChI=1S/C12H16O3S/c1-6-9-10(7-2)12(16(5)13)15-8(3)11(9)14-4/h1-2,8-12H,3-5H3 |
| InChIKey | CFSYVBPMXMLLGZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|