C17H24N2O7S2 — CID 89455375
2-[4-methoxy-3-[[2-morpholin-4-ylethyl(sulfino)amino]methyl]benzoyl]sulfanylacetic acid (PubChem CID 89455375) has the molecular formula C17H24N2O7S2 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-[4-methoxy-3-[[2-morpholin-4-ylethyl(sulfino)amino]methyl]benzoyl]sulfanylacetic acid.
| Compound Name | 2-[4-methoxy-3-[[2-morpholin-4-ylethyl(sulfino)amino]methyl]benzoyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 89455375 |
| Molecular Formula | C17H24N2O7S2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 2-[4-methoxy-3-[[2-morpholin-4-ylethyl(sulfino)amino]methyl]benzoyl]sulfanylacetic acid |
| SMILES | COc1ccc(C(=O)SCC(=O)O)cc1CN(CCN1CCOCC1)S(=O)O |
| InChI | InChI=1S/C17H24N2O7S2/c1-25-15-3-2-13(17(22)27-12-16(20)21)10-14(15)11-19(28(23)24)5-4-18-6-8-26-9-7-18/h2-3,10H,4-9,11-12H2,1H3,(H,20,21)(H,23,24) |
| InChIKey | PZLNEIOITCKCDE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|