C21H19N3O3S — CID 89469445
N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-(2,3-dimethylphenyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 89469445) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-(2,3-dimethylphenyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-(2,3-dimethylphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 89469445 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-(2,3-dimethylphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cccc(-c2nc(C)c(C(=O)N/N=C/c3ccc4c(c3)OCO4)s2)c1C |
| InChI | InChI=1S/C21H19N3O3S/c1-12-5-4-6-16(13(12)2)21-23-14(3)19(28-21)20(25)24-22-10-15-7-8-17-18(9-15)27-11-26-17/h4-10H,11H2,1-3H3,(H,24,25)/b22-10+ |
| InChIKey | GVYLNAVYRHEUJR-LSHDLFTRSA-N |
| XLogP | 4.23 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|