C24H21N5O6 — CID 6031426
2-N,4-N-bis[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3,5-dimethyl-1H-pyrrole-2,4-dicarboxamide (PubChem CID 6031426) has the molecular formula C24H21N5O6 and a molecular weight of 475.46 g/mol. Its IUPAC name is 2-N,4-N-bis[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3,5-dimethyl-1H-pyrrole-2,4-dicarboxamide.
| Compound Name | 2-N,4-N-bis[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3,5-dimethyl-1H-pyrrole-2,4-dicarboxamide |
|---|---|
| PubChem CID | 6031426 |
| Molecular Formula | C24H21N5O6 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 2-N,4-N-bis[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3,5-dimethyl-1H-pyrrole-2,4-dicarboxamide |
| SMILES | Cc1[nH]c(C(=O)N/N=C\c2ccc3c(c2)OCO3)c(C)c1C(=O)N/N=C\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H21N5O6/c1-13-21(23(30)28-25-9-15-3-5-17-19(7-15)34-11-32-17)14(2)27-22(13)24(31)29-26-10-16-4-6-18-20(8-16)35-12-33-18/h3-10,27H,11-12H2,1-2H3,(H,28,30)(H,29,31)/b25-9-,26-10- |
| InChIKey | OESKNOYZTTYVBR-UMOSFCNPSA-N |
| XLogP | 2.62 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|