C25H20N4O3S — CID 24879413
2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-N-[(E)-benzylideneamino]-4,5-dimethylthieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 24879413) has the molecular formula C25H20N4O3S and a molecular weight of 456.53 g/mol. Its IUPAC name is 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-N-[(E)-benzylideneamino]-4,5-dimethylthieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-N-[(E)-benzylideneamino]-4,5-dimethylthieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 24879413 |
| Molecular Formula | C25H20N4O3S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-N-[(E)-benzylideneamino]-4,5-dimethylthieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1nc(/C=C/c2ccc3c(c2)OCO3)nc2sc(C(=O)N/N=C/c3ccccc3)c(C)c12 |
| InChI | InChI=1S/C25H20N4O3S/c1-15-22-16(2)27-21(11-9-17-8-10-19-20(12-17)32-14-31-19)28-25(22)33-23(15)24(30)29-26-13-18-6-4-3-5-7-18/h3-13H,14H2,1-2H3,(H,29,30)/b11-9+,26-13+ |
| InChIKey | CDMMCKHKNNHRSH-YTLSUWDGSA-N |
| XLogP | 4.97 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|