C31H25NO9 — CID 89473348
4-[(1E,6E)-4-[acetamido-(4-carboxyphenyl)methyl]-7-(4-carboxyphenyl)-3,5-dioxohepta-1,6-dienyl]benzoic acid (PubChem CID 89473348) has the molecular formula C31H25NO9 and a molecular weight of 555.54 g/mol. Its IUPAC name is 4-[(1E,6E)-4-[acetamido-(4-carboxyphenyl)methyl]-7-(4-carboxyphenyl)-3,5-dioxohepta-1,6-dienyl]benzoic acid.
| Compound Name | 4-[(1E,6E)-4-[acetamido-(4-carboxyphenyl)methyl]-7-(4-carboxyphenyl)-3,5-dioxohepta-1,6-dienyl]benzoic acid |
|---|---|
| PubChem CID | 89473348 |
| Molecular Formula | C31H25NO9 |
| Molecular Weight | 555.54 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | 4-[(1E,6E)-4-[acetamido-(4-carboxyphenyl)methyl]-7-(4-carboxyphenyl)-3,5-dioxohepta-1,6-dienyl]benzoic acid |
| SMILES | CC(=O)NC(c1ccc(C(=O)O)cc1)C(C(=O)/C=C/c1ccc(C(=O)O)cc1)C(=O)/C=C/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C31H25NO9/c1-18(33)32-28(21-12-14-24(15-13-21)31(40)41)27(25(34)16-6-19-2-8-22(9-3-19)29(36)37)26(35)17-7-20-4-10-23(11-5-20)30(38)39/h2-17,27-28H,1H3,(H,32,33)(H,36,37)(H,38,39)(H,40,41)/b16-6+,17-7+ |
| InChIKey | HTUGZYPPSSDYQS-KGMKFKQSSA-N |
| XLogP | 4.14 |
| TPSA | 175.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|