C30H25NO9 — CID 71537006
4-[(E)-5-(3,5-dihydroxyphenyl)-2-[(E)-3-(3,5-dihydroxyphenyl)prop-2-enoyl]-3-oxo-1-(prop-2-enoylamino)pent-4-enyl]benzoic acid (PubChem CID 71537006) has the molecular formula C30H25NO9 and a molecular weight of 543.53 g/mol. Its IUPAC name is 4-[(E)-5-(3,5-dihydroxyphenyl)-2-[(E)-3-(3,5-dihydroxyphenyl)prop-2-enoyl]-3-oxo-1-(prop-2-enoylamino)pent-4-enyl]benzoic acid.
| Compound Name | 4-[(E)-5-(3,5-dihydroxyphenyl)-2-[(E)-3-(3,5-dihydroxyphenyl)prop-2-enoyl]-3-oxo-1-(prop-2-enoylamino)pent-4-enyl]benzoic acid |
|---|---|
| PubChem CID | 71537006 |
| Molecular Formula | C30H25NO9 |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 4-[(E)-5-(3,5-dihydroxyphenyl)-2-[(E)-3-(3,5-dihydroxyphenyl)prop-2-enoyl]-3-oxo-1-(prop-2-enoylamino)pent-4-enyl]benzoic acid |
| SMILES | C=CC(=O)NC(c1ccc(C(=O)O)cc1)C(C(=O)/C=C/c1cc(O)cc(O)c1)C(=O)/C=C/c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C30H25NO9/c1-2-27(38)31-29(19-5-7-20(8-6-19)30(39)40)28(25(36)9-3-17-11-21(32)15-22(33)12-17)26(37)10-4-18-13-23(34)16-24(35)14-18/h2-16,28-29,32-35H,1H2,(H,31,38)(H,39,40)/b9-3+,10-4+ |
| InChIKey | HOPNGUVSLSMMPC-LQIBPGRFSA-N |
| XLogP | 3.73 |
| TPSA | 181.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|