C6H13N3O3 — CID 89478149
(2S)-2-(ethylamino)-N-hydroxybutanediamide (PubChem CID 89478149) has the molecular formula C6H13N3O3 and a molecular weight of 175.19 g/mol. Its IUPAC name is (2S)-2-(ethylamino)-N-hydroxybutanediamide.
| Compound Name | (2S)-2-(ethylamino)-N-hydroxybutanediamide |
|---|---|
| PubChem CID | 89478149 |
| Molecular Formula | C6H13N3O3 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (2S)-2-(ethylamino)-N-hydroxybutanediamide |
| SMILES | CCN[C@@H](CC(N)=O)C(=O)NO |
| InChI | InChI=1S/C6H13N3O3/c1-2-8-4(3-5(7)10)6(11)9-12/h4,8,12H,2-3H2,1H3,(H2,7,10)(H,9,11)/t4-/m0/s1 |
| InChIKey | BYCHBRJUCYIPDQ-BYPYZUCNSA-N |
| XLogP | -1.65 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|