C18H23N5O2 — CID 89479047
(4S)-3-[2-[[(1S)-1-(4-aminophenyl)ethyl]amino]pyrimidin-4-yl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 89479047) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is (4S)-3-[2-[[(1S)-1-(4-aminophenyl)ethyl]amino]pyrimidin-4-yl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[2-[[(1S)-1-(4-aminophenyl)ethyl]amino]pyrimidin-4-yl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 89479047 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (4S)-3-[2-[[(1S)-1-(4-aminophenyl)ethyl]amino]pyrimidin-4-yl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@H]1COC(=O)N1c1ccnc(N[C@@H](C)c2ccc(N)cc2)n1 |
| InChI | InChI=1S/C18H23N5O2/c1-11(2)15-10-25-18(24)23(15)16-8-9-20-17(22-16)21-12(3)13-4-6-14(19)7-5-13/h4-9,11-12,15H,10,19H2,1-3H3,(H,20,21,22)/t12-,15+/m0/s1 |
| InChIKey | DMWSMDBHPPIDAA-SWLSCSKDSA-N |
| XLogP | 3.21 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|