C29H37Cl2N3O — CID 89482069
(3S,5R,6S)-5-(3-chlorophenyl)-6-[4-(4-chlorophenyl)-3-methyl-4-piperazin-1-ylbutan-2-yl]-3-prop-2-enylpiperidin-2-one (PubChem CID 89482069) has the molecular formula C29H37Cl2N3O and a molecular weight of 514.54 g/mol. Its IUPAC name is (3S,5R,6S)-5-(3-chlorophenyl)-6-[4-(4-chlorophenyl)-3-methyl-4-piperazin-1-ylbutan-2-yl]-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-[4-(4-chlorophenyl)-3-methyl-4-piperazin-1-ylbutan-2-yl]-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 89482069 |
| Molecular Formula | C29H37Cl2N3O |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-[4-(4-chlorophenyl)-3-methyl-4-piperazin-1-ylbutan-2-yl]-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@H]1C[C@H](c2cccc(Cl)c2)[C@H](C(C)C(C)C(c2ccc(Cl)cc2)N2CCNCC2)NC1=O |
| InChI | InChI=1S/C29H37Cl2N3O/c1-4-6-23-18-26(22-7-5-8-25(31)17-22)27(33-29(23)35)19(2)20(3)28(34-15-13-32-14-16-34)21-9-11-24(30)12-10-21/h4-5,7-12,17,19-20,23,26-28,32H,1,6,13-16,18H2,2-3H3,(H,33,35)/t19?,20?,23-,26+,27-,28?/m0/s1 |
| InChIKey | NTQVLUFTFXVUGL-MBHWKANHSA-N |
| XLogP | 6.08 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|