C26H31Cl2NO — CID 89481245
(3S,5R,6S)-5-(3-chlorophenyl)-6-[1-(4-chlorophenyl)-3-methylpentan-3-yl]-3-prop-2-enylpiperidin-2-one (PubChem CID 89481245) has the molecular formula C26H31Cl2NO and a molecular weight of 444.45 g/mol. Its IUPAC name is (3S,5R,6S)-5-(3-chlorophenyl)-6-[1-(4-chlorophenyl)-3-methylpentan-3-yl]-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-[1-(4-chlorophenyl)-3-methylpentan-3-yl]-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 89481245 |
| Molecular Formula | C26H31Cl2NO |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-[1-(4-chlorophenyl)-3-methylpentan-3-yl]-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@H]1C[C@H](c2cccc(Cl)c2)[C@@H](C(C)(CC)CCc2ccc(Cl)cc2)NC1=O |
| InChI | InChI=1S/C26H31Cl2NO/c1-4-7-20-17-23(19-8-6-9-22(28)16-19)24(29-25(20)30)26(3,5-2)15-14-18-10-12-21(27)13-11-18/h4,6,8-13,16,20,23-24H,1,5,7,14-15,17H2,2-3H3,(H,29,30)/t20-,23+,24-,26?/m0/s1 |
| InChIKey | FFZXZPBFXBXMPV-WCBRJXBRSA-N |
| XLogP | 7.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|