C21H21Cl2NO — CID 141326913
5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-prop-2-enylpiperidin-2-one (PubChem CID 141326913) has the molecular formula C21H21Cl2NO and a molecular weight of 374.31 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-prop-2-enylpiperidin-2-one.
| Compound Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 141326913 |
| Molecular Formula | C21H21Cl2NO |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-prop-2-enylpiperidin-2-one |
| SMILES | C=CCN1C(=O)C(C)CC(c2cccc(Cl)c2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21Cl2NO/c1-3-11-24-20(15-7-9-17(22)10-8-15)19(12-14(2)21(24)25)16-5-4-6-18(23)13-16/h3-10,13-14,19-20H,1,11-12H2,2H3 |
| InChIKey | TYYJNKOXEXBKDJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|