C25H27Cl2NO — CID 70644681
5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-(dicyclopropylmethyl)-3-methylpiperidin-2-one (PubChem CID 70644681) has the molecular formula C25H27Cl2NO and a molecular weight of 428.40 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-(dicyclopropylmethyl)-3-methylpiperidin-2-one.
| Compound Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-(dicyclopropylmethyl)-3-methylpiperidin-2-one |
|---|---|
| PubChem CID | 70644681 |
| Molecular Formula | C25H27Cl2NO |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-(dicyclopropylmethyl)-3-methylpiperidin-2-one |
| SMILES | CC1CC(c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N(C(C2CC2)C2CC2)C1=O |
| InChI | InChI=1S/C25H27Cl2NO/c1-15-13-22(19-3-2-4-21(27)14-19)24(18-9-11-20(26)12-10-18)28(25(15)29)23(16-5-6-16)17-7-8-17/h2-4,9-12,14-17,22-24H,5-8,13H2,1H3 |
| InChIKey | PYYLORHMSCHDKG-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |