C11H18N2O — CID 89482515
1-[(3aR,6aR)-1-cyclopropyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-5-yl]ethanone (PubChem CID 89482515) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-[(3aR,6aR)-1-cyclopropyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-5-yl]ethanone.
| Compound Name | 1-[(3aR,6aR)-1-cyclopropyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-5-yl]ethanone |
|---|---|
| PubChem CID | 89482515 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-[(3aR,6aR)-1-cyclopropyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-5-yl]ethanone |
| SMILES | CC(=O)N1C[C@H]2CCN(C3CC3)[C@H]2C1 |
| InChI | InChI=1S/C11H18N2O/c1-8(14)12-6-9-4-5-13(10-2-3-10)11(9)7-12/h9-11H,2-7H2,1H3/t9-,11+/m1/s1 |
| InChIKey | HVDJKYBABVRDGB-KOLCDFICSA-N |
| XLogP | 0.70 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |