C22H29N3O2 — CID 134431915
ethyl 1-(4-cyano-4-phenylcyclohexyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrole-5-carboxylate (PubChem CID 134431915) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is ethyl 1-(4-cyano-4-phenylcyclohexyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrole-5-carboxylate.
| Compound Name | ethyl 1-(4-cyano-4-phenylcyclohexyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 134431915 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | ethyl 1-(4-cyano-4-phenylcyclohexyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)N1CC2CCN(C3CCC(C#N)(c4ccccc4)CC3)C2C1 |
| InChI | InChI=1S/C22H29N3O2/c1-2-27-21(26)24-14-17-10-13-25(20(17)15-24)19-8-11-22(16-23,12-9-19)18-6-4-3-5-7-18/h3-7,17,19-20H,2,8-15H2,1H3 |
| InChIKey | WECDLSTYRXPTLN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |