C19H29N3 — CID 91257528
4-[3-(aminomethyl)azetidin-1-yl]-1-phenylcyclohexane-1-carbonitrile;ethane (PubChem CID 91257528) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 4-[3-(aminomethyl)azetidin-1-yl]-1-phenylcyclohexane-1-carbonitrile;ethane.
| Compound Name | 4-[3-(aminomethyl)azetidin-1-yl]-1-phenylcyclohexane-1-carbonitrile;ethane |
|---|---|
| PubChem CID | 91257528 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 4-[3-(aminomethyl)azetidin-1-yl]-1-phenylcyclohexane-1-carbonitrile;ethane |
| SMILES | CC.N#CC1(c2ccccc2)CCC(N2CC(CN)C2)CC1 |
| InChI | InChI=1S/C17H23N3.C2H6/c18-10-14-11-20(12-14)16-6-8-17(13-19,9-7-16)15-4-2-1-3-5-15;1-2/h1-5,14,16H,6-12,18H2;1-2H3 |
| InChIKey | GHXQOWGDVNPJQW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |