C9H15N2O- — CID 59704487
1-(5-methanidyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)ethanone (PubChem CID 59704487) has the molecular formula C9H15N2O- and a molecular weight of 167.23 g/mol. Its IUPAC name is 1-(5-methanidyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)ethanone.
| Compound Name | 1-(5-methanidyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)ethanone |
|---|---|
| PubChem CID | 59704487 |
| Molecular Formula | C9H15N2O- |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | 1-(5-methanidyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)ethanone |
| SMILES | [CH2-]N1CC2CCN(C(C)=O)C2C1 |
| InChI | InChI=1S/C9H15N2O/c1-7(12)11-4-3-8-5-10(2)6-9(8)11/h8-9H,2-6H2,1H3/q-1 |
| InChIKey | OEAQVZWELTXELA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|