C20H23NO4S2 — CID 8948302
[2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 2-(2,3-dihydro-1H-inden-5-yloxy)acetate (PubChem CID 8948302) has the molecular formula C20H23NO4S2 and a molecular weight of 405.54 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 2-(2,3-dihydro-1H-inden-5-yloxy)acetate.
| Compound Name | [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 2-(2,3-dihydro-1H-inden-5-yloxy)acetate |
|---|---|
| PubChem CID | 8948302 |
| Molecular Formula | C20H23NO4S2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 2-(2,3-dihydro-1H-inden-5-yloxy)acetate |
| SMILES | O=C(COC(=O)COc1ccc2c(c1)CCC2)NCCSCc1cccs1 |
| InChI | InChI=1S/C20H23NO4S2/c22-19(21-8-10-26-14-18-5-2-9-27-18)12-25-20(23)13-24-17-7-6-15-3-1-4-16(15)11-17/h2,5-7,9,11H,1,3-4,8,10,12-14H2,(H,21,22) |
| InChIKey | JCKUXSYBFXQAQQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|