C23H24N2O4 — CID 89483150
carbonic acid;2-cyclohexyloxy-4,5-diphenylpyrimidine (PubChem CID 89483150) has the molecular formula C23H24N2O4 and a molecular weight of 392.45 g/mol. Its IUPAC name is carbonic acid;2-cyclohexyloxy-4,5-diphenylpyrimidine.
| Compound Name | carbonic acid;2-cyclohexyloxy-4,5-diphenylpyrimidine |
|---|---|
| PubChem CID | 89483150 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | carbonic acid;2-cyclohexyloxy-4,5-diphenylpyrimidine |
| SMILES | O=C(O)O.c1ccc(-c2cnc(OC3CCCCC3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N2O.CH2O3/c1-4-10-17(11-5-1)20-16-23-22(25-19-14-8-3-9-15-19)24-21(20)18-12-6-2-7-13-18;2-1(3)4/h1-2,4-7,10-13,16,19H,3,8-9,14-15H2;(H2,2,3,4) |
| InChIKey | HOAIHVXTKRDYAX-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |