C14H20N2O3 — CID 89486960
2-(3,4-dimethoxyphenyl)-N-[2-(dimethylamino)ethylidene]acetamide (PubChem CID 89486960) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[2-(dimethylamino)ethylidene]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[2-(dimethylamino)ethylidene]acetamide |
|---|---|
| PubChem CID | 89486960 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[2-(dimethylamino)ethylidene]acetamide |
| SMILES | COc1ccc(CC(=O)/N=C/CN(C)C)cc1OC |
| InChI | InChI=1S/C14H20N2O3/c1-16(2)8-7-15-14(17)10-11-5-6-12(18-3)13(9-11)19-4/h5-7,9H,8,10H2,1-4H3/b15-7+ |
| InChIKey | DCYPHJUHIMPOFI-VIZOYTHASA-N |
| XLogP | 1.41 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|