C10H15N5 — CID 89488883
N'-cyano-4-(cyanomethyl)-4-methylpiperidine-1-carboximidamide (PubChem CID 89488883) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is N'-cyano-4-(cyanomethyl)-4-methylpiperidine-1-carboximidamide.
| Compound Name | N'-cyano-4-(cyanomethyl)-4-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 89488883 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N'-cyano-4-(cyanomethyl)-4-methylpiperidine-1-carboximidamide |
| SMILES | CC1(CC#N)CCN(/C(N)=N/C#N)CC1 |
| InChI | InChI=1S/C10H15N5/c1-10(2-5-11)3-6-15(7-4-10)9(13)14-8-12/h2-4,6-7H2,1H3,(H2,13,14) |
| InChIKey | MCLBOSHOYHYYCO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 89.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|