C28H23NO5 — CID 89497893
2-[4-(2-benzoyl-5H-furo[3,2-g]chromen-3-yl)phenoxy]-2-(dimethylamino)acetaldehyde (PubChem CID 89497893) has the molecular formula C28H23NO5 and a molecular weight of 453.49 g/mol. Its IUPAC name is 2-[4-(2-benzoyl-5H-furo[3,2-g]chromen-3-yl)phenoxy]-2-(dimethylamino)acetaldehyde.
| Compound Name | 2-[4-(2-benzoyl-5H-furo[3,2-g]chromen-3-yl)phenoxy]-2-(dimethylamino)acetaldehyde |
|---|---|
| PubChem CID | 89497893 |
| Molecular Formula | C28H23NO5 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 2-[4-(2-benzoyl-5H-furo[3,2-g]chromen-3-yl)phenoxy]-2-(dimethylamino)acetaldehyde |
| SMILES | CN(C)C(C=O)Oc1ccc(-c2c(C(=O)c3ccccc3)oc3cc4c(cc23)CC=CO4)cc1 |
| InChI | InChI=1S/C28H23NO5/c1-29(2)25(17-30)33-21-12-10-18(11-13-21)26-22-15-20-9-6-14-32-23(20)16-24(22)34-28(26)27(31)19-7-4-3-5-8-19/h3-8,10-17,25H,9H2,1-2H3 |
| InChIKey | GJQXMVWADVREPX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|