C20H25N3O3 — CID 89499424
N-(2-cyano-1-methoxypropan-2-yl)-2-(3-ethylquinolin-6-yl)oxybutanamide (PubChem CID 89499424) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(2-cyano-1-methoxypropan-2-yl)-2-(3-ethylquinolin-6-yl)oxybutanamide.
| Compound Name | N-(2-cyano-1-methoxypropan-2-yl)-2-(3-ethylquinolin-6-yl)oxybutanamide |
|---|---|
| PubChem CID | 89499424 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-(2-cyano-1-methoxypropan-2-yl)-2-(3-ethylquinolin-6-yl)oxybutanamide |
| SMILES | CCc1cnc2ccc(OC(CC)C(=O)NC(C)(C#N)COC)cc2c1 |
| InChI | InChI=1S/C20H25N3O3/c1-5-14-9-15-10-16(7-8-17(15)22-11-14)26-18(6-2)19(24)23-20(3,12-21)13-25-4/h7-11,18H,5-6,13H2,1-4H3,(H,23,24) |
| InChIKey | XIUOHPKVDBOCBS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |