C18H14ClFN2O3S — CID 8958557
[(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate (PubChem CID 8958557) has the molecular formula C18H14ClFN2O3S and a molecular weight of 392.84 g/mol. Its IUPAC name is [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate.
| Compound Name | [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 8958557 |
| Molecular Formula | C18H14ClFN2O3S |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate |
| SMILES | Cc1c(C(=O)O[C@H](C)C(=O)Nc2cccnc2Cl)sc2cccc(F)c12 |
| InChI | InChI=1S/C18H14ClFN2O3S/c1-9-14-11(20)5-3-7-13(14)26-15(9)18(24)25-10(2)17(23)22-12-6-4-8-21-16(12)19/h3-8,10H,1-2H3,(H,22,23)/t10-/m1/s1 |
| InChIKey | GTBOMEMKYTWSGS-SNVBAGLBSA-N |
| XLogP | 4.58 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|