C22H23N3O3 — CID 8982304
2-(3-oxo-1,4-benzoxazin-4-yl)-N-[[(2S)-2-phenylcyclohexylidene]amino]acetamide (PubChem CID 8982304) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-(3-oxo-1,4-benzoxazin-4-yl)-N-[[(2S)-2-phenylcyclohexylidene]amino]acetamide.
| Compound Name | 2-(3-oxo-1,4-benzoxazin-4-yl)-N-[[(2S)-2-phenylcyclohexylidene]amino]acetamide |
|---|---|
| PubChem CID | 8982304 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-(3-oxo-1,4-benzoxazin-4-yl)-N-[[(2S)-2-phenylcyclohexylidene]amino]acetamide |
| SMILES | O=C(CN1C(=O)COc2ccccc21)NN=C1CCCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H23N3O3/c26-21(14-25-19-12-6-7-13-20(19)28-15-22(25)27)24-23-18-11-5-4-10-17(18)16-8-2-1-3-9-16/h1-3,6-9,12-13,17H,4-5,10-11,14-15H2,(H,24,26)/t17-/m0/s1 |
| InChIKey | UJIANKHRWHCHKA-KRWDZBQOSA-N |
| XLogP | 3.24 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|