C24H30N3O4+ — CID 8993374
4-[(2S)-2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propanoyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 8993374) has the molecular formula C24H30N3O4+ and a molecular weight of 424.52 g/mol. Its IUPAC name is 4-[(2S)-2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propanoyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[(2S)-2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propanoyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 8993374 |
| Molecular Formula | C24H30N3O4+ |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 4-[(2S)-2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propanoyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | CCOc1cc2c(cc1OCC)C[NH+]([C@@H](C)C(=O)N1CC(=O)Nc3ccccc31)CC2 |
| InChI | InChI=1S/C24H29N3O4/c1-4-30-21-12-17-10-11-26(14-18(17)13-22(21)31-5-2)16(3)24(29)27-15-23(28)25-19-8-6-7-9-20(19)27/h6-9,12-13,16H,4-5,10-11,14-15H2,1-3H3,(H,25,28)/p+1/t16-/m0/s1 |
| InChIKey | MWEUZBQHQNOQEF-INIZCTEOSA-O |
| XLogP | 1.80 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |