C12H12N2O2S2 — CID 90002714
1-benzyl-2,4-dithia-6,8-diazabicyclo[3.2.2]nonane-7,9-dione (PubChem CID 90002714) has the molecular formula C12H12N2O2S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-benzyl-2,4-dithia-6,8-diazabicyclo[3.2.2]nonane-7,9-dione.
| Compound Name | 1-benzyl-2,4-dithia-6,8-diazabicyclo[3.2.2]nonane-7,9-dione |
|---|---|
| PubChem CID | 90002714 |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 1-benzyl-2,4-dithia-6,8-diazabicyclo[3.2.2]nonane-7,9-dione |
| SMILES | O=C1NC2(Cc3ccccc3)SCSC1NC2=O |
| InChI | InChI=1S/C12H12N2O2S2/c15-9-10-13-11(16)12(14-9,18-7-17-10)6-8-4-2-1-3-5-8/h1-5,10H,6-7H2,(H,13,16)(H,14,15) |
| InChIKey | ZWZDTTPOPRXZKQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |