C23H30ClN5O4 — CID 90012480
butyl 4-[5-[[1-(6-chloropyridazin-3-yl)pyrrolidin-3-yl]carbamoyl]furan-2-yl]piperidine-1-carboxylate (PubChem CID 90012480) has the molecular formula C23H30ClN5O4 and a molecular weight of 475.98 g/mol. Its IUPAC name is butyl 4-[5-[[1-(6-chloropyridazin-3-yl)pyrrolidin-3-yl]carbamoyl]furan-2-yl]piperidine-1-carboxylate.
| Compound Name | butyl 4-[5-[[1-(6-chloropyridazin-3-yl)pyrrolidin-3-yl]carbamoyl]furan-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90012480 |
| Molecular Formula | C23H30ClN5O4 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | butyl 4-[5-[[1-(6-chloropyridazin-3-yl)pyrrolidin-3-yl]carbamoyl]furan-2-yl]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(c2ccc(C(=O)NC3CCN(c4ccc(Cl)nn4)C3)o2)CC1 |
| InChI | InChI=1S/C23H30ClN5O4/c1-2-3-14-32-23(31)28-11-8-16(9-12-28)18-4-5-19(33-18)22(30)25-17-10-13-29(15-17)21-7-6-20(24)26-27-21/h4-7,16-17H,2-3,8-15H2,1H3,(H,25,30) |
| InChIKey | HVKAXTRWJKCOJD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|