C17H22ClF2N3O — CID 90015405
2-chloro-6-(3,3-difluoropyrrolidin-1-yl)-4-[1-(oxetan-3-yl)piperidin-4-yl]pyridine (PubChem CID 90015405) has the molecular formula C17H22ClF2N3O and a molecular weight of 357.83 g/mol. Its IUPAC name is 2-chloro-6-(3,3-difluoropyrrolidin-1-yl)-4-[1-(oxetan-3-yl)piperidin-4-yl]pyridine.
| Compound Name | 2-chloro-6-(3,3-difluoropyrrolidin-1-yl)-4-[1-(oxetan-3-yl)piperidin-4-yl]pyridine |
|---|---|
| PubChem CID | 90015405 |
| Molecular Formula | C17H22ClF2N3O |
| Molecular Weight | 357.83 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-chloro-6-(3,3-difluoropyrrolidin-1-yl)-4-[1-(oxetan-3-yl)piperidin-4-yl]pyridine |
| SMILES | FC1(F)CCN(c2cc(C3CCN(C4COC4)CC3)cc(Cl)n2)C1 |
| InChI | InChI=1S/C17H22ClF2N3O/c18-15-7-13(8-16(21-15)23-6-3-17(19,20)11-23)12-1-4-22(5-2-12)14-9-24-10-14/h7-8,12,14H,1-6,9-11H2 |
| InChIKey | AWBCUOJVSVJBQT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.83 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|