C14H12ClF2N3 — CID 90015001
2-chloro-6-(3,3-difluoropyrrolidin-1-yl)-4-pyridin-3-ylpyridine (PubChem CID 90015001) has the molecular formula C14H12ClF2N3 and a molecular weight of 295.72 g/mol. Its IUPAC name is 2-chloro-6-(3,3-difluoropyrrolidin-1-yl)-4-pyridin-3-ylpyridine.
| Compound Name | 2-chloro-6-(3,3-difluoropyrrolidin-1-yl)-4-pyridin-3-ylpyridine |
|---|---|
| PubChem CID | 90015001 |
| Molecular Formula | C14H12ClF2N3 |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-chloro-6-(3,3-difluoropyrrolidin-1-yl)-4-pyridin-3-ylpyridine |
| SMILES | FC1(F)CCN(c2cc(-c3cccnc3)cc(Cl)n2)C1 |
| InChI | InChI=1S/C14H12ClF2N3/c15-12-6-11(10-2-1-4-18-8-10)7-13(19-12)20-5-3-14(16,17)9-20/h1-2,4,6-8H,3,5,9H2 |
| InChIKey | NJFXOAPTKHNWDG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|