benzyl 2H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate

C14H12N2O2S — CID 90022529

IUPACbenzyl 2H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate
SMILESO=C(OCc1ccccc1)N1C=CC2=NCSC2=C1
InChIInChI=1S/C14H12N2O2S/c17-14(18-9-11-4-2-1-3-5-11)16-7-6-12-13(8-16)19-10-15-12/h1-8H,9-10H2
InChIKeyQHSQHLNGIOAARE-UHFFFAOYSA-N
MW272.33 g/mol
LogP3.14
Rot. Bonds2

About benzyl 2H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate

benzyl 2H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate (PubChem CID 90022529) has the molecular formula C14H12N2O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is benzyl 2H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate.

Molecular Properties

Compound Namebenzyl 2H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate
PubChem CID90022529
Molecular FormulaC14H12N2O2S
Molecular Weight272.33 g/mol
Exact Mass272.06
IUPAC Namebenzyl 2H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate
SMILESO=C(OCc1ccccc1)N1C=CC2=NCSC2=C1
InChIInChI=1S/C14H12N2O2S/c17-14(18-9-11-4-2-1-3-5-11)16-7-6-12-13(8-16)19-10-15-12/h1-8H,9-10H2
InChIKeyQHSQHLNGIOAARE-UHFFFAOYSA-N
XLogP3.14
TPSA41.90 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.33
LogP ≤ 53.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl 2H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate?
The IUPAC name of benzyl 2H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate (CID 90022529) is benzyl 2H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate.
What is the SMILES notation for benzyl 2H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate?
The canonical SMILES for benzyl 2H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate is O=C(OCc1ccccc1)N1C=CC2=NCSC2=C1.
What is the InChIKey of benzyl 2H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate?
The InChIKey is QHSQHLNGIOAARE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2S/c17-14(18-9-11-4-2-1-3-5-11)16-7-6-12-13(8-16)19-10-15-12/h1-8H,9-10H2.
What are the key properties of benzyl 2H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate?
benzyl 2H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate has a molecular weight of 272.33 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate is sourced from PubChem (CID 90022529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).