C14H12N2O2S — CID 141131376
pyridin-2-ylmethyl 2H-thieno[2,3-c]pyridine-6-carboxylate (PubChem CID 141131376) has the molecular formula C14H12N2O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is pyridin-2-ylmethyl 2H-thieno[2,3-c]pyridine-6-carboxylate.
| Compound Name | pyridin-2-ylmethyl 2H-thieno[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 141131376 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | pyridin-2-ylmethyl 2H-thieno[2,3-c]pyridine-6-carboxylate |
| SMILES | O=C(OCc1ccccn1)N1C=CC2=CCSC2=C1 |
| InChI | InChI=1S/C14H12N2O2S/c17-14(18-10-12-3-1-2-6-15-12)16-7-4-11-5-8-19-13(11)9-16/h1-7,9H,8,10H2 |
| InChIKey | AWYMDVAIBXYRNO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |