C18H24N2O3 — CID 90024528
3-formamido-2-hydroxy-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzamide (PubChem CID 90024528) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-formamido-2-hydroxy-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzamide.
| Compound Name | 3-formamido-2-hydroxy-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzamide |
|---|---|
| PubChem CID | 90024528 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 3-formamido-2-hydroxy-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzamide |
| SMILES | CC1(C)C2CCC1(C)C(NC(=O)c1cccc(NC=O)c1O)C2 |
| InChI | InChI=1S/C18H24N2O3/c1-17(2)11-7-8-18(17,3)14(9-11)20-16(23)12-5-4-6-13(15(12)22)19-10-21/h4-6,10-11,14,22H,7-9H2,1-3H3,(H,19,21)(H,20,23) |
| InChIKey | IIASNIFYJMSXKE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|