C6H13ClF2N2 — CID 90026544
(4,4-Difluorocyclohexyl)hydrazine hydrochloride (PubChem CID 90026544) has the molecular formula C6H13ClF2N2 and a molecular weight of 186.63 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)hydrazine;hydrochloride.
| Compound Name | (4,4-Difluorocyclohexyl)hydrazine hydrochloride |
|---|---|
| PubChem CID | 90026544 |
| Molecular Formula | C6H13ClF2N2 |
| Molecular Weight | 186.63 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | (4,4-difluorocyclohexyl)hydrazine;hydrochloride |
| SMILES | C1CC(CCC1NN)(F)F.Cl |
| InChI | InChI=1S/C6H12F2N2.ClH/c7-6(8)3-1-5(10-9)2-4-6;/h5,10H,1-4,9H2;1H |
| InChIKey | XZQWRGCSYNTOLR-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 38.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | 106 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|