C17H14FN7O2S — CID 90028911
2-(4-fluorophenyl)-4-[1-[(4-nitrophenyl)methyl]-2,3-dihydrotetrazol-5-yl]-1H-pyrazole-3-thione (PubChem CID 90028911) has the molecular formula C17H14FN7O2S and a molecular weight of 399.41 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-[1-[(4-nitrophenyl)methyl]-2,3-dihydrotetrazol-5-yl]-1H-pyrazole-3-thione.
| Compound Name | 2-(4-fluorophenyl)-4-[1-[(4-nitrophenyl)methyl]-2,3-dihydrotetrazol-5-yl]-1H-pyrazole-3-thione |
|---|---|
| PubChem CID | 90028911 |
| Molecular Formula | C17H14FN7O2S |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2-(4-fluorophenyl)-4-[1-[(4-nitrophenyl)methyl]-2,3-dihydrotetrazol-5-yl]-1H-pyrazole-3-thione |
| SMILES | O=[N+]([O-])c1ccc(CN2NNN=C2c2c[nH]n(-c3ccc(F)cc3)c2=S)cc1 |
| InChI | InChI=1S/C17H14FN7O2S/c18-12-3-7-13(8-4-12)24-17(28)15(9-19-24)16-20-21-22-23(16)10-11-1-5-14(6-2-11)25(26)27/h1-9,19,21-22H,10H2 |
| InChIKey | GITHYJWHPTZAPK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|