C12H12ClN7O2 — CID 90033024
5-(3-chloro-1-methylpyrazol-4-yl)-1-[(4-nitrophenyl)methyl]-2,3-dihydrotetrazole (PubChem CID 90033024) has the molecular formula C12H12ClN7O2 and a molecular weight of 321.73 g/mol. Its IUPAC name is 5-(3-chloro-1-methylpyrazol-4-yl)-1-[(4-nitrophenyl)methyl]-2,3-dihydrotetrazole.
| Compound Name | 5-(3-chloro-1-methylpyrazol-4-yl)-1-[(4-nitrophenyl)methyl]-2,3-dihydrotetrazole |
|---|---|
| PubChem CID | 90033024 |
| Molecular Formula | C12H12ClN7O2 |
| Molecular Weight | 321.73 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 5-(3-chloro-1-methylpyrazol-4-yl)-1-[(4-nitrophenyl)methyl]-2,3-dihydrotetrazole |
| SMILES | Cn1cc(C2=NNNN2Cc2ccc([N+](=O)[O-])cc2)c(Cl)n1 |
| InChI | InChI=1S/C12H12ClN7O2/c1-18-7-10(11(13)15-18)12-14-16-17-19(12)6-8-2-4-9(5-3-8)20(21)22/h2-5,7,16-17H,6H2,1H3 |
| InChIKey | GQXTUJZDTRTPQW-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.73 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|