About [4-tert-butyl-2-(6-methylheptanoyloxy)phenyl] 6-methylheptanoate
[4-tert-butyl-2-(6-methylheptanoyloxy)phenyl] 6-methylheptanoate (PubChem CID 90032215) has the molecular formula C26H42O4
and a molecular weight of 418.62 g/mol. Its IUPAC name is [4-tert-butyl-2-(6-methylheptanoyloxy)phenyl] 6-methylheptanoate.
Molecular Properties
| Compound Name | [4-tert-butyl-2-(6-methylheptanoyloxy)phenyl] 6-methylheptanoate |
| PubChem CID | 90032215 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | [4-tert-butyl-2-(6-methylheptanoyloxy)phenyl] 6-methylheptanoate |
| SMILES | CC(C)CCCCC(=O)Oc1ccc(C(C)(C)C)cc1OC(=O)CCCCC(C)C |
| InChI | InChI=1S/C26H42O4/c1-19(2)12-8-10-14-24(27)29-22-17-16-21(26(5,6)7)18-23(22)30-25(28)15-11-9-13-20(3)4/h16-20H,8-15H2,1-7H3 |
| InChIKey | IOJDDLGMADBISS-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-tert-butyl-2-(6-methylheptanoyloxy)phenyl] 6-methylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-tert-butyl-2-(6-methylheptanoyloxy)phenyl] 6-methylheptanoate?
The IUPAC name of [4-tert-butyl-2-(6-methylheptanoyloxy)phenyl] 6-methylheptanoate (CID 90032215) is [4-tert-butyl-2-(6-methylheptanoyloxy)phenyl] 6-methylheptanoate.
What is the SMILES notation for [4-tert-butyl-2-(6-methylheptanoyloxy)phenyl] 6-methylheptanoate?
The canonical SMILES for [4-tert-butyl-2-(6-methylheptanoyloxy)phenyl] 6-methylheptanoate is CC(C)CCCCC(=O)Oc1ccc(C(C)(C)C)cc1OC(=O)CCCCC(C)C.
What is the InChIKey of [4-tert-butyl-2-(6-methylheptanoyloxy)phenyl] 6-methylheptanoate?
The InChIKey is IOJDDLGMADBISS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H42O4/c1-19(2)12-8-10-14-24(27)29-22-17-16-21(26(5,6)7)18-23(22)30-25(28)15-11-9-13-20(3)4/h16-20H,8-15H2,1-7H3.
What are the key properties of [4-tert-butyl-2-(6-methylheptanoyloxy)phenyl] 6-methylheptanoate?
[4-tert-butyl-2-(6-methylheptanoyloxy)phenyl] 6-methylheptanoate has a molecular weight of 418.62 g/mol, XLogP of 7.23, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-tert-butyl-2-(6-methylheptanoyloxy)phenyl] 6-methylheptanoate is sourced from PubChem (CID 90032215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).