C6H15N3O — CID 90034039
4-(1,2-diaminoethyl)pyrrolidin-3-ol (PubChem CID 90034039) has the molecular formula C6H15N3O and a molecular weight of 145.21 g/mol. Its IUPAC name is 4-(1,2-diaminoethyl)pyrrolidin-3-ol.
| Compound Name | 4-(1,2-diaminoethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 90034039 |
| Molecular Formula | C6H15N3O |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | 4-(1,2-diaminoethyl)pyrrolidin-3-ol |
| SMILES | NCC(N)C1CNCC1O |
| InChI | InChI=1S/C6H15N3O/c7-1-5(8)4-2-9-3-6(4)10/h4-6,9-10H,1-3,7-8H2 |
| InChIKey | AKDJPHMBIITIRR-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |