C26H34ClNO5 — CID 90036513
ethyl 5-(butoxycarbonylamino)-5-[4-(3-chlorophenyl)phenyl]-2-(hydroxymethyl)-2-methylpentanoate (PubChem CID 90036513) has the molecular formula C26H34ClNO5 and a molecular weight of 476.01 g/mol. Its IUPAC name is ethyl 5-(butoxycarbonylamino)-5-[4-(3-chlorophenyl)phenyl]-2-(hydroxymethyl)-2-methylpentanoate.
| Compound Name | ethyl 5-(butoxycarbonylamino)-5-[4-(3-chlorophenyl)phenyl]-2-(hydroxymethyl)-2-methylpentanoate |
|---|---|
| PubChem CID | 90036513 |
| Molecular Formula | C26H34ClNO5 |
| Molecular Weight | 476.01 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | ethyl 5-(butoxycarbonylamino)-5-[4-(3-chlorophenyl)phenyl]-2-(hydroxymethyl)-2-methylpentanoate |
| SMILES | CCCCOC(=O)NC(CCC(C)(CO)C(=O)OCC)c1ccc(-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C26H34ClNO5/c1-4-6-16-33-25(31)28-23(14-15-26(3,18-29)24(30)32-5-2)20-12-10-19(11-13-20)21-8-7-9-22(27)17-21/h7-13,17,23,29H,4-6,14-16,18H2,1-3H3,(H,28,31) |
| InChIKey | IIYUDOKKXKKSRL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.01 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|