C21H34ClNO3Si — CID 90206135
butyl N-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-1-(3-chlorophenyl)but-3-en-2-yl]carbamate (PubChem CID 90206135) has the molecular formula C21H34ClNO3Si and a molecular weight of 412.05 g/mol. Its IUPAC name is butyl N-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-1-(3-chlorophenyl)but-3-en-2-yl]carbamate.
| Compound Name | butyl N-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-1-(3-chlorophenyl)but-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 90206135 |
| Molecular Formula | C21H34ClNO3Si |
| Molecular Weight | 412.05 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | butyl N-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-1-(3-chlorophenyl)but-3-en-2-yl]carbamate |
| SMILES | C=C[C@@H](NC(=O)OCCCC)[C@@H](O[Si](C)(C)C(C)(C)C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H34ClNO3Si/c1-8-10-14-25-20(24)23-18(9-2)19(16-12-11-13-17(22)15-16)26-27(6,7)21(3,4)5/h9,11-13,15,18-19H,2,8,10,14H2,1,3-7H3,(H,23,24)/t18-,19+/m1/s1 |
| InChIKey | BSWGBNUUTSFXJP-MOPGFXCFSA-N |
| XLogP | 6.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.05 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|