C26H39ClN2O3Si — CID 67809990
ethyl 2-[4-[2-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(3-chlorophenyl)ethyl]amino]ethylamino]phenyl]acetate (PubChem CID 67809990) has the molecular formula C26H39ClN2O3Si and a molecular weight of 491.15 g/mol. Its IUPAC name is ethyl 2-[4-[2-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(3-chlorophenyl)ethyl]amino]ethylamino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[2-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(3-chlorophenyl)ethyl]amino]ethylamino]phenyl]acetate |
|---|---|
| PubChem CID | 67809990 |
| Molecular Formula | C26H39ClN2O3Si |
| Molecular Weight | 491.15 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | ethyl 2-[4-[2-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(3-chlorophenyl)ethyl]amino]ethylamino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(NCCNCC(O[Si](C)(C)C(C)(C)C)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C26H39ClN2O3Si/c1-7-31-25(30)17-20-11-13-23(14-12-20)29-16-15-28-19-24(21-9-8-10-22(27)18-21)32-33(5,6)26(2,3)4/h8-14,18,24,28-29H,7,15-17,19H2,1-6H3 |
| InChIKey | WENRVTPZEMKQSI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.15 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|