C24H30ClNO5 — CID 90036146
3-(butoxycarbonylamino)-5-[4-(3-chlorophenyl)phenyl]-2-(hydroxymethyl)-2-methylpentanoic acid (PubChem CID 90036146) has the molecular formula C24H30ClNO5 and a molecular weight of 447.96 g/mol. Its IUPAC name is 3-(butoxycarbonylamino)-5-[4-(3-chlorophenyl)phenyl]-2-(hydroxymethyl)-2-methylpentanoic acid.
| Compound Name | 3-(butoxycarbonylamino)-5-[4-(3-chlorophenyl)phenyl]-2-(hydroxymethyl)-2-methylpentanoic acid |
|---|---|
| PubChem CID | 90036146 |
| Molecular Formula | C24H30ClNO5 |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 3-(butoxycarbonylamino)-5-[4-(3-chlorophenyl)phenyl]-2-(hydroxymethyl)-2-methylpentanoic acid |
| SMILES | CCCCOC(=O)NC(CCc1ccc(-c2cccc(Cl)c2)cc1)C(C)(CO)C(=O)O |
| InChI | InChI=1S/C24H30ClNO5/c1-3-4-14-31-23(30)26-21(24(2,16-27)22(28)29)13-10-17-8-11-18(12-9-17)19-6-5-7-20(25)15-19/h5-9,11-12,15,21,27H,3-4,10,13-14,16H2,1-2H3,(H,26,30)(H,28,29) |
| InChIKey | HIEHOEVFDKOUJU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|