C18H16N4O2 — CID 90041141
6-benzyl-7,8-dimethoxy-3H-pyrazolo[5,4-c]cinnoline (PubChem CID 90041141) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 6-benzyl-7,8-dimethoxy-3H-pyrazolo[5,4-c]cinnoline.
| Compound Name | 6-benzyl-7,8-dimethoxy-3H-pyrazolo[5,4-c]cinnoline |
|---|---|
| PubChem CID | 90041141 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 6-benzyl-7,8-dimethoxy-3H-pyrazolo[5,4-c]cinnoline |
| SMILES | COc1cc2c(nnc3[nH]ncc32)c(Cc2ccccc2)c1OC |
| InChI | InChI=1S/C18H16N4O2/c1-23-15-9-12-14-10-19-21-18(14)22-20-16(12)13(17(15)24-2)8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H,19,21,22) |
| InChIKey | RRRQONSVCCMVLG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |