C18H26F2N2O4 — CID 90044303
(2S,3R,4R,5R,6S)-6-(difluoromethyl)-N-ethyl-3,4,5-trihydroxy-N-(3-phenylpropyl)piperidine-2-carboxamide (PubChem CID 90044303) has the molecular formula C18H26F2N2O4 and a molecular weight of 372.41 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-6-(difluoromethyl)-N-ethyl-3,4,5-trihydroxy-N-(3-phenylpropyl)piperidine-2-carboxamide.
| Compound Name | (2S,3R,4R,5R,6S)-6-(difluoromethyl)-N-ethyl-3,4,5-trihydroxy-N-(3-phenylpropyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 90044303 |
| Molecular Formula | C18H26F2N2O4 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (2S,3R,4R,5R,6S)-6-(difluoromethyl)-N-ethyl-3,4,5-trihydroxy-N-(3-phenylpropyl)piperidine-2-carboxamide |
| SMILES | CCN(CCCc1ccccc1)C(=O)[C@H]1N[C@H](C(F)F)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H26F2N2O4/c1-2-22(10-6-9-11-7-4-3-5-8-11)18(26)13-15(24)16(25)14(23)12(21-13)17(19)20/h3-5,7-8,12-17,21,23-25H,2,6,9-10H2,1H3/t12-,13-,14+,15+,16-/m0/s1 |
| InChIKey | LZHROCJIJMFUJQ-RBZJEDDUSA-N |
| XLogP | 0.16 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |