C18H28N2O5 — CID 90044322
(2S,3R,4S,5R,6R)-N-ethyl-3,4,5-trihydroxy-6-(hydroxymethyl)-N-(3-phenylpropyl)piperidine-2-carboxamide (PubChem CID 90044322) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-N-ethyl-3,4,5-trihydroxy-6-(hydroxymethyl)-N-(3-phenylpropyl)piperidine-2-carboxamide.
| Compound Name | (2S,3R,4S,5R,6R)-N-ethyl-3,4,5-trihydroxy-6-(hydroxymethyl)-N-(3-phenylpropyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 90044322 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (2S,3R,4S,5R,6R)-N-ethyl-3,4,5-trihydroxy-6-(hydroxymethyl)-N-(3-phenylpropyl)piperidine-2-carboxamide |
| SMILES | CCN(CCCc1ccccc1)C(=O)[C@H]1N[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H28N2O5/c1-2-20(10-6-9-12-7-4-3-5-8-12)18(25)14-16(23)17(24)15(22)13(11-21)19-14/h3-5,7-8,13-17,19,21-24H,2,6,9-11H2,1H3/t13-,14+,15-,16-,17+/m1/s1 |
| InChIKey | NJJKEJZHFAJTBP-JJTUDDRGSA-N |
| XLogP | -1.12 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |