C18H25F3N2O3 — CID 90044789
(2S,3R,4S,5R,6S)-6-(difluoromethyl)-N-ethyl-4-fluoro-3,5-dihydroxy-N-(3-phenylpropyl)piperidine-2-carboxamide (PubChem CID 90044789) has the molecular formula C18H25F3N2O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is (2S,3R,4S,5R,6S)-6-(difluoromethyl)-N-ethyl-4-fluoro-3,5-dihydroxy-N-(3-phenylpropyl)piperidine-2-carboxamide.
| Compound Name | (2S,3R,4S,5R,6S)-6-(difluoromethyl)-N-ethyl-4-fluoro-3,5-dihydroxy-N-(3-phenylpropyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 90044789 |
| Molecular Formula | C18H25F3N2O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | (2S,3R,4S,5R,6S)-6-(difluoromethyl)-N-ethyl-4-fluoro-3,5-dihydroxy-N-(3-phenylpropyl)piperidine-2-carboxamide |
| SMILES | CCN(CCCc1ccccc1)C(=O)[C@H]1N[C@H](C(F)F)[C@@H](O)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C18H25F3N2O3/c1-2-23(10-6-9-11-7-4-3-5-8-11)18(26)14-16(25)12(19)15(24)13(22-14)17(20)21/h3-5,7-8,12-17,22,24-25H,2,6,9-10H2,1H3/t12-,13+,14+,15+,16+/m1/s1 |
| InChIKey | XLTRZJZECJLFHX-YXMSTPNBSA-N |
| XLogP | 1.13 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |